CAS 320346-78-9 appears in our catalog under these names: Tiotropium Bromide Impurity 1, Aclidinium Bromide Impurity 3((S)-Aclidinium Bromide), (S)-Aclidinium Bromide, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(3S)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide (CAS 320346-78-9) is a chemical compound with the molecular formula C26H30BrNO4S2 and a molecular weight of 564.6 g/mol. IUPAC name: [(3S)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide. InChIKey: XLAKJQPTOJHYDR-YBICHJLKSA-M.
| Molecular formula | C26H30BrNO4S2 |
|---|---|
| Molecular weight | 564.6 g/mol |
| IUPAC name | [(3S)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide |
| InChIKey | XLAKJQPTOJHYDR-YBICHJLKSA-M |
| SMILES | C1C[N+]2(CCC1[C@@H](C2)OC(=O)C(C3=CC=CS3)(C4=CC=CS4)O)CCCOC5=CC=CC=C5.[Br-] |
Computed by PubChem (NCBI)