CAS 320367-63-3 is the registry number for 6-Chloro-n,n'-bis(3,4-dimethylphenyl)-1,3,5-triazine-2,4-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-chloro-2-N,4-N-bis(3,4-dimethylphenyl)-1,3,5-triazine-2,4-diamine (CAS 320367-63-3) is a chemical compound with the molecular formula C19H20ClN5 and a molecular weight of 353.8 g/mol. IUPAC name: 6-chloro-2-N,4-N-bis(3,4-dimethylphenyl)-1,3,5-triazine-2,4-diamine. InChIKey: CVEIPCJKNKJLKJ-UHFFFAOYSA-N.
| Molecular formula | C19H20ClN5 |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | 6-chloro-2-N,4-N-bis(3,4-dimethylphenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | CVEIPCJKNKJLKJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC2=NC(=NC(=N2)Cl)NC3=CC(=C(C=C3)C)C)C |
Computed by PubChem (NCBI)