Products 320416-07-7
CAS 320416-07-7 is the registry number for 1-(Dimethylamino)-5-(4-fluorophenyl)-1,4-pentadien-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(1E,4E)-1-(dimethylamino)-5-(4-fluorophenyl)penta-1,4-dien-3-one (CAS 320416-07-7) is a chemical compound with the molecular formula C13H14FNO and a molecular weight of 219.25 g/mol. IUPAC name: (1E,4E)-1-(dimethylamino)-5-(4-fluorophenyl)penta-1,4-dien-3-one. InChIKey: PLHISVOJZASQEM-CPSCNVPRSA-N.
| Molecular formula | C13H14FNO |
|---|---|
| Molecular weight | 219.25 g/mol |
| IUPAC name | (1E,4E)-1-(dimethylamino)-5-(4-fluorophenyl)penta-1,4-dien-3-one |
| InChIKey | PLHISVOJZASQEM-CPSCNVPRSA-N |
| SMILES | CN(C)/C=C/C(=O)/C=C/C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)