CAS 320417-11-6 is the registry number for Methyl 4-(4-fluorophenoxy)-3-nitrobenzenecarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 4-(4-fluorophenoxy)-3-nitrobenzoate (CAS 320417-11-6) is a chemical compound with the molecular formula C14H10FNO5 and a molecular weight of 291.23 g/mol. IUPAC name: methyl 4-(4-fluorophenoxy)-3-nitrobenzoate. InChIKey: VOPSYKKSSYANRA-UHFFFAOYSA-N.
| Molecular formula | C14H10FNO5 |
|---|---|
| Molecular weight | 291.23 g/mol |
| IUPAC name | methyl 4-(4-fluorophenoxy)-3-nitrobenzoate |
| InChIKey | VOPSYKKSSYANRA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)OC2=CC=C(C=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)