CAS 320576-20-3 appears in our catalog under these names: 4-[2-(3,4-Dimethoxyphenyl)-1,2-dibromoethyl]-1,2-dimethoxybenzene, 95%, 4-(2-(3,4-Dimethoxyphenyl)-1,2-dibromoethyl)-1,2-dimethoxybenzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
4-[1,2-dibromo-2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethoxybenzene (CAS 320576-20-3) is a chemical compound with the molecular formula C18H20Br2O4 and a molecular weight of 460.2 g/mol. IUPAC name: 4-[1,2-dibromo-2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethoxybenzene. InChIKey: MBBHHOGFBDEQMC-UHFFFAOYSA-N.
| Molecular formula | C18H20Br2O4 |
|---|---|
| Molecular weight | 460.2 g/mol |
| IUPAC name | 4-[1,2-dibromo-2-(3,4-dimethoxyphenyl)ethyl]-1,2-dimethoxybenzene |
| InChIKey | MBBHHOGFBDEQMC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(C(C2=CC(=C(C=C2)OC)OC)Br)Br)OC |
Computed by PubChem (NCBI)