CAS 320576-22-5 appears in our catalog under these names: 1,3-Diphenyl-5-(2-aminophenyl)pyrazole, 1,3-Diphenyl-5-(2-aminophenyl)pyrazole, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 1000mg, 500mg, 2000mg, 250mg, 1g.
2-(1,3-diphenylpyrazol-5-yl)aniline (CAS 320576-22-5) is a chemical compound with the molecular formula C21H17N3 and a molecular weight of 311.4 g/mol. IUPAC name: 2-(1,3-diphenylpyrazol-5-yl)aniline. InChIKey: ODLHPFCCSPUYTF-UHFFFAOYSA-N.
| Molecular formula | C21H17N3 |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 2-(1,3-diphenylpyrazol-5-yl)aniline |
| InChIKey | ODLHPFCCSPUYTF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C(=C2)C3=CC=CC=C3N)C4=CC=CC=C4 |
Computed by PubChem (NCBI)