Products 320600-01-9

CAS 320600-01-9 is the registry number for 2,6-Diethyl-4-phenylpyronium tetrafluoroborate. Offered by: Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 1000mg.

Structural formula: {0} (CAS {1})

2,6-diethyl-4-phenylpyrylium tetrafluoroborate (CAS 320600-01-9) is a chemical compound with the molecular formula C15H17BF4O and a molecular weight of 300.10 g/mol. IUPAC name: 2,6-diethyl-4-phenylpyrylium tetrafluoroborate. InChIKey: OMISKEMLQKQFFK-UHFFFAOYSA-N.

Identity
Molecular formulaC15H17BF4O
Molecular weight300.10 g/mol
IUPAC name2,6-diethyl-4-phenylpyrylium tetrafluoroborate
InChIKeyOMISKEMLQKQFFK-UHFFFAOYSA-N
SMILES[B-](F)(F)(F)F.CCC1=CC(=CC(=[O+]1)CC)C2=CC=CC=C2

Computed by PubChem (NCBI)