CAS 320600-01-9 is the registry number for 2,6-Diethyl-4-phenylpyronium tetrafluoroborate. Offered by: Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 1000mg.
2,6-diethyl-4-phenylpyrylium tetrafluoroborate (CAS 320600-01-9) is a chemical compound with the molecular formula C15H17BF4O and a molecular weight of 300.10 g/mol. IUPAC name: 2,6-diethyl-4-phenylpyrylium tetrafluoroborate. InChIKey: OMISKEMLQKQFFK-UHFFFAOYSA-N.
| Molecular formula | C15H17BF4O |
|---|---|
| Molecular weight | 300.10 g/mol |
| IUPAC name | 2,6-diethyl-4-phenylpyrylium tetrafluoroborate |
| InChIKey | OMISKEMLQKQFFK-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CCC1=CC(=CC(=[O+]1)CC)C2=CC=CC=C2 |
Computed by PubChem (NCBI)