CAS 320600-07-5 appears in our catalog under these names: 2,6-Dichloro-1,5-dinitronaphthalene, 95%, 2,6-Dichloro-1,5-dinitronaphthalene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 1000mg, 500mg, 2000mg.
2,6-dichloro-1,5-dinitronaphthalene (CAS 320600-07-5) is a chemical compound with the molecular formula C10H4Cl2N2O4 and a molecular weight of 287.05 g/mol. IUPAC name: 2,6-dichloro-1,5-dinitronaphthalene. InChIKey: SNTDSCHHIHWCDK-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl2N2O4 |
|---|---|
| Molecular weight | 287.05 g/mol |
| IUPAC name | 2,6-dichloro-1,5-dinitronaphthalene |
| InChIKey | SNTDSCHHIHWCDK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=C(C=C2)Cl)[N+](=O)[O-])[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)