Products 320624-68-8
CAS 320624-68-8 is the registry number for Marmin acetonide. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 50mg, 25mg, Get quote.
7-[(E)-3-methyl-5-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]pent-2-enoxy]chromen-2-one (CAS 320624-68-8) is a chemical compound with the molecular formula C22H28O5 and a molecular weight of 372.5 g/mol. IUPAC name: 7-[(E)-3-methyl-5-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]pent-2-enoxy]chromen-2-one. InChIKey: AECCGECAEDOGOS-LBKOFNPBSA-N.
| Molecular formula | C22H28O5 |
|---|---|
| Molecular weight | 372.5 g/mol |
| IUPAC name | 7-[(E)-3-methyl-5-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]pent-2-enoxy]chromen-2-one |
| InChIKey | AECCGECAEDOGOS-LBKOFNPBSA-N |
| SMILES | C/C(=C\COC1=CC2=C(C=C1)C=CC(=O)O2)/CC[C@@H]3C(OC(O3)(C)C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Marmin acetonide, orb1682158