CAS 320749-62-0 is the registry number for 1H-Imidazolium, 1,1′-(1,3-propanediyl)bis[3-methyl-, bis[hexafluorophosphate(1-)], 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-methyl-3-[3-(3-methylimidazol-3-ium-1-yl)propyl]imidazol-1-ium dihexafluorophosphate (CAS 320749-62-0) is a chemical compound with the molecular formula C11H18F12N4P2 and a molecular weight of 496.22 g/mol. IUPAC name: 1-methyl-3-[3-(3-methylimidazol-3-ium-1-yl)propyl]imidazol-1-ium dihexafluorophosphate. InChIKey: ZPLWQHIMHNZCBD-UHFFFAOYSA-N.
| Molecular formula | C11H18F12N4P2 |
|---|---|
| Molecular weight | 496.22 g/mol |
| IUPAC name | 1-methyl-3-[3-(3-methylimidazol-3-ium-1-yl)propyl]imidazol-1-ium dihexafluorophosphate |
| InChIKey | ZPLWQHIMHNZCBD-UHFFFAOYSA-N |
| SMILES | C[N+]1=CN(C=C1)CCCN2C=C[N+](=C2)C.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)