CAS 32093-35-9 is the registry number for Levamisole Phosphate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(6S)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole;phosphoric acid (CAS 32093-35-9) is a chemical compound with the molecular formula C11H15N2O4PS and a molecular weight of 302.29 g/mol. IUPAC name: (6S)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole;phosphoric acid. InChIKey: QEMMFDPTLWDHKP-HNCPQSOCSA-N.
| Molecular formula | C11H15N2O4PS |
|---|---|
| Molecular weight | 302.29 g/mol |
| IUPAC name | (6S)-6-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole;phosphoric acid |
| InChIKey | QEMMFDPTLWDHKP-HNCPQSOCSA-N |
| SMILES | C1CSC2=N[C@H](CN21)C3=CC=CC=C3.OP(=O)(O)O |
Computed by PubChem (NCBI)