CAS 321-63-1 appears in our catalog under these names: 4'-Fluoro[1,1'-biphenyl]-2-amine, 95%, 4'-Fluorobiphenyl-2-amine, 95-<97%, 4'-Fluorobiphenyl-2-amine, ≥97-<99%, 4'-Fluoro-(1,1'-biphenyl)-2-amine, 95%, 4'-Fluorobiphenyl-2-ylamine hydrochloride. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 25g, 50g.
2-(4-fluorophenyl)aniline (CAS 321-63-1) is a chemical compound with the molecular formula C12H10FN and a molecular weight of 187.21 g/mol. IUPAC name: 2-(4-fluorophenyl)aniline. InChIKey: OIRYNNTWJJMYNB-UHFFFAOYSA-N.
| Molecular formula | C12H10FN |
|---|---|
| Molecular weight | 187.21 g/mol |
| IUPAC name | 2-(4-fluorophenyl)aniline |
| InChIKey | OIRYNNTWJJMYNB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)F)N |
Computed by PubChem (NCBI)