CAS 321-97-1 appears in our catalog under these names: (-)-Pseudoephedrine, (-)-Pseudoephedrine ((1R,2R)-Pseudoephedrine), (-)-Pseudoephedrine 1.0 mg/ml in Methanol, (-)-Pseudoephedrine, 1mg/ml in Acetonitrile, (1R,2R)-(-)-PSEUDOEPHEDRINE, 98%. Offered by: Lipomed, LoGiCal, Mikromol, Sigma-Aldrich. Available pack sizes: 50mg, 100mg, 10mg, 25mg, 1ml, 100G, 25G.
(1R,2R)-2-(methylamino)-1-phenylpropan-1-ol (CAS 321-97-1) is a chemical compound with the molecular formula C10H15NO and a molecular weight of 165.23 g/mol. IUPAC name: (1R,2R)-2-(methylamino)-1-phenylpropan-1-ol. InChIKey: KWGRBVOPPLSCSI-SCZZXKLOSA-N.
| Molecular formula | C10H15NO |
|---|---|
| Molecular weight | 165.23 g/mol |
| IUPAC name | (1R,2R)-2-(methylamino)-1-phenylpropan-1-ol |
| InChIKey | KWGRBVOPPLSCSI-SCZZXKLOSA-N |
| SMILES | C[C@H]([C@@H](C1=CC=CC=C1)O)NC |
Computed by PubChem (NCBI)