CAS 3211-86-7 is the registry number for rac-((1R,2R,4R)-Bicyclo(2.2.1)hept-5-en-2-yl)methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methanamine (CAS 3211-86-7) is a chemical compound with the molecular formula C8H13N and a molecular weight of 123.20 g/mol. IUPAC name: [(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methanamine. InChIKey: XLBALIGLOMYEKN-CSMHCCOUSA-N.
| Molecular formula | C8H13N |
|---|---|
| Molecular weight | 123.20 g/mol |
| IUPAC name | [(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methanamine |
| InChIKey | XLBALIGLOMYEKN-CSMHCCOUSA-N |
| SMILES | C1[C@@H]2C[C@H]([C@H]1C=C2)CN |
Computed by PubChem (NCBI)