CAS 32116-25-9 is the registry number for 2-Acetyl-5-nitropyrrole. Offered by: TRC. Available pack sizes: 2,5g.
1-(5-nitro-1H-pyrrol-2-yl)ethanone (CAS 32116-25-9) is a chemical compound with the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. IUPAC name: 1-(5-nitro-1H-pyrrol-2-yl)ethanone. InChIKey: LIJJWPMRFYFJFR-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O3 |
|---|---|
| Molecular weight | 154.12 g/mol |
| IUPAC name | 1-(5-nitro-1H-pyrrol-2-yl)ethanone |
| InChIKey | LIJJWPMRFYFJFR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)