Products 32118-53-9
CAS 32118-53-9 is the registry number for 3-Methyl-2-(propan-2-yl)butanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-methyl-2-propan-2-ylbutanoic acid (CAS 32118-53-9) is a chemical compound with the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. IUPAC name: 3-methyl-2-propan-2-ylbutanoic acid. InChIKey: GSZKHLKKYPBXKM-UHFFFAOYSA-N.
| Molecular formula | C8H16O2 |
|---|---|
| Molecular weight | 144.21 g/mol |
| IUPAC name | 3-methyl-2-propan-2-ylbutanoic acid |
| InChIKey | GSZKHLKKYPBXKM-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(C)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-isopropyl-3-methylbutanoic acid, Butanoic acid, 3-methyl-2-(1-methylethyl)-, Diisopropylacetic acid, 2-Isopropyl-3-methylbutyric acid, 3-Methyl-2-(1-methylethyl)butanoic acid, InChI=1/C8H16O2/c1-5(2)7(6(3)4)8(9)10/h5-7H,1-4H3,(H,9,10, 3-methyl-2-(propan-2-yl)butanoic acid, 3-methyl-2-propan-2-ylbutanoic acid, Butanoic acid,3-methyl-2-(1-methylethyl)-, dii-propylacetic acid