CAS 32120-43-7 is the registry number for 3-Deoxy-2-keto-6-phospho-D-galactonate lithium salt. Offered by: Biosynth. Available pack sizes: 1g.
6-phospho-2-dehydro-3-deoxy-D-galactonic acid is a ketoaldonic acid phosphate. It has a role as an Escherichia coli metabolite. It is functionally related to a D-galactonic acid. It is a conjugate acid of a 6-phosphonato-2-dehydro-3-deoxy-D-galactate(3-).
Source: ChEBI
| Molecular formula | C6H11O9P |
|---|---|
| Molecular weight | 258.12 g/mol |
| IUPAC name | (4R,5R)-4,5-dihydroxy-2-oxo-6-phosphonooxyhexanoic acid |
| InChIKey | OVPRPPOVAXRCED-NQXXGFSBSA-N |
| SMILES | C([C@H]([C@@H](COP(=O)(O)O)O)O)C(=O)C(=O)O |
Computed by PubChem (NCBI)