CAS 321309-32-4 appears in our catalog under these names: 1,2,3-Benzothiadiazole-5-carbonyl chloride, 95%, 1,2,3-Benzothiadiazole-5-carbonyl chloride, 95% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 1g, 250mg, 5g.
1,2,3-benzothiadiazole-5-carbonyl chloride (CAS 321309-32-4) is a chemical compound with the molecular formula C7H3ClN2OS and a molecular weight of 198.63 g/mol. IUPAC name: 1,2,3-benzothiadiazole-5-carbonyl chloride. InChIKey: VOSTUOLSYXVSND-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2OS |
|---|---|
| Molecular weight | 198.63 g/mol |
| IUPAC name | 1,2,3-benzothiadiazole-5-carbonyl chloride |
| InChIKey | VOSTUOLSYXVSND-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)Cl)N=NS2 |
Computed by PubChem (NCBI)