CAS 32137-73-8 appears in our catalog under these names: 2-(Trimethylsilyl)benzothiazole, 95%, 2-(Trimethylsilyl)benzothiazole tech. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
1,3-benzothiazol-2-yl(trimethyl)silane (CAS 32137-73-8) is a chemical compound with the molecular formula C10H13NSSi and a molecular weight of 207.37 g/mol. IUPAC name: 1,3-benzothiazol-2-yl(trimethyl)silane. InChIKey: MNXBVXVIRAIAEG-UHFFFAOYSA-N.
| Molecular formula | C10H13NSSi |
|---|---|
| Molecular weight | 207.37 g/mol |
| IUPAC name | 1,3-benzothiazol-2-yl(trimethyl)silane |
| InChIKey | MNXBVXVIRAIAEG-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=NC2=CC=CC=C2S1 |
Computed by PubChem (NCBI)