CAS 321372-40-1 is the registry number for LN002. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-amino-3-[1-cyano-2-(5-phenyl-1H-pyrazol-4-yl)ethenyl]-1-phenylpyrazole-4-carbonitrile (CAS 321372-40-1) is a chemical compound with the molecular formula C22H15N7 and a molecular weight of 377.4 g/mol. IUPAC name: 5-amino-3-[1-cyano-2-(5-phenyl-1H-pyrazol-4-yl)ethenyl]-1-phenylpyrazole-4-carbonitrile. InChIKey: GNVKIBOBCIVULL-UHFFFAOYSA-N.
| Molecular formula | C22H15N7 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | 5-amino-3-[1-cyano-2-(5-phenyl-1H-pyrazol-4-yl)ethenyl]-1-phenylpyrazole-4-carbonitrile |
| InChIKey | GNVKIBOBCIVULL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=NN2)C=C(C#N)C3=NN(C(=C3C#N)N)C4=CC=CC=C4 |
Computed by PubChem (NCBI)