CAS 32151-75-0 appears in our catalog under these names: Metformin Impurity 6, Metformin Impurity 29, Metformin Impurity 11. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[4,6-bis(diaminomethylideneamino)-1,3,5-triazin-2-yl]guanidine (CAS 32151-75-0) is a chemical compound with the molecular formula C6H12N12 and a molecular weight of 252.24 g/mol. IUPAC name: 2-[4,6-bis(diaminomethylideneamino)-1,3,5-triazin-2-yl]guanidine. InChIKey: CLFLCYSTLXORFC-UHFFFAOYSA-N.
| Molecular formula | C6H12N12 |
|---|---|
| Molecular weight | 252.24 g/mol |
| IUPAC name | 2-[4,6-bis(diaminomethylideneamino)-1,3,5-triazin-2-yl]guanidine |
| InChIKey | CLFLCYSTLXORFC-UHFFFAOYSA-N |
| SMILES | C1(=NC(=NC(=N1)N=C(N)N)N=C(N)N)N=C(N)N |
Computed by PubChem (NCBI)