CAS 321531-64-0 appears in our catalog under these names: Dimethyl 2-(phenylsulfonamido)terephthalate, 95%, Dimethyl 2–(Phenylsulfonamido)terephthalate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg.
Dimethyl 2-(benzenesulfonamido)benzene-1,4-dicarboxylate (CAS 321531-64-0) is a chemical compound with the molecular formula C16H15NO6S and a molecular weight of 349.4 g/mol. IUPAC name: dimethyl 2-(benzenesulfonamido)benzene-1,4-dicarboxylate. InChIKey: NIAIIHQWIMCYDK-UHFFFAOYSA-N.
| Molecular formula | C16H15NO6S |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | dimethyl 2-(benzenesulfonamido)benzene-1,4-dicarboxylate |
| InChIKey | NIAIIHQWIMCYDK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)OC)NS(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)