Products 321531-70-8
CAS 321531-70-8 is the registry number for N-Cycloheptyl-2,4,6-trimethylbenzene-1-sulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N-cycloheptyl-2,4,6-trimethylbenzenesulfonamide (CAS 321531-70-8) is a chemical compound with the molecular formula C16H25NO2S and a molecular weight of 295.4 g/mol. IUPAC name: N-cycloheptyl-2,4,6-trimethylbenzenesulfonamide. InChIKey: ARNMPSRYBDZPRN-UHFFFAOYSA-N.
| Molecular formula | C16H25NO2S |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | N-cycloheptyl-2,4,6-trimethylbenzenesulfonamide |
| InChIKey | ARNMPSRYBDZPRN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)NC2CCCCCC2)C |
Computed by PubChem (NCBI)