CAS 321571-55-5 is the registry number for 1-(2-Amino-6-chloro-4-pyrimidinyl)-4-methylhexahydropyrazin-4-ium chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-chloro-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine;hydrochloride (CAS 321571-55-5) is a chemical compound with the molecular formula C9H15Cl2N5 and a molecular weight of 264.15 g/mol. IUPAC name: 4-chloro-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine;hydrochloride. InChIKey: ANNGRMPYRQRFDK-UHFFFAOYSA-N.
| Molecular formula | C9H15Cl2N5 |
|---|---|
| Molecular weight | 264.15 g/mol |
| IUPAC name | 4-chloro-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine;hydrochloride |
| InChIKey | ANNGRMPYRQRFDK-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC(=NC(=N2)N)Cl.Cl |
Computed by PubChem (NCBI)