CAS 321588-97-0 is the registry number for Voriconazole Impurity 47. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-6-[3-(2,6-dichloro-5-fluoropyrimidin-4-yl)butan-2-yl]-5-fluoropyrimidine (CAS 321588-97-0) is a chemical compound with the molecular formula C12H8Cl4F2N4 and a molecular weight of 388.0 g/mol. IUPAC name: 2,4-dichloro-6-[3-(2,6-dichloro-5-fluoropyrimidin-4-yl)butan-2-yl]-5-fluoropyrimidine. InChIKey: SUXKPIKKVOHHHQ-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl4F2N4 |
|---|---|
| Molecular weight | 388.0 g/mol |
| IUPAC name | 2,4-dichloro-6-[3-(2,6-dichloro-5-fluoropyrimidin-4-yl)butan-2-yl]-5-fluoropyrimidine |
| InChIKey | SUXKPIKKVOHHHQ-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C(=NC(=N1)Cl)Cl)F)C(C)C2=C(C(=NC(=N2)Cl)Cl)F |
Computed by PubChem (NCBI)