CAS 321720-12-1 is the registry number for 4-chloro-N-((4-fluorophenyl)methyl)benzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 250mg.
4-chloro-N-[(4-fluorophenyl)methyl]benzenesulfonamide (CAS 321720-12-1) is a chemical compound with the molecular formula C13H11ClFNO2S and a molecular weight of 299.75 g/mol. IUPAC name: 4-chloro-N-[(4-fluorophenyl)methyl]benzenesulfonamide. InChIKey: OLRRQEPAUAJFFL-UHFFFAOYSA-N.
| Molecular formula | C13H11ClFNO2S |
|---|---|
| Molecular weight | 299.75 g/mol |
| IUPAC name | 4-chloro-N-[(4-fluorophenyl)methyl]benzenesulfonamide |
| InChIKey | OLRRQEPAUAJFFL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNS(=O)(=O)C2=CC=C(C=C2)Cl)F |
Computed by PubChem (NCBI)