Products 321936-04-3

CAS 321936-04-3 appears in our catalog under these names: Mal-PEG-COOH average Mw2000, 97% average Mw2000, Mal-PEG-COOH average Mw5000, 97% average Mw5000. Offered by: Ambeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]acetic acid (CAS 321936-04-3) is a chemical compound with the molecular formula C13H18N2O7 and a molecular weight of 314.29 g/mol. IUPAC name: 2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]acetic acid. InChIKey: WVZNYUWSKCVCLO-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18N2O7
Molecular weight314.29 g/mol
IUPAC name2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]acetic acid
InChIKeyWVZNYUWSKCVCLO-UHFFFAOYSA-N
SMILESC1=CC(=O)N(C1=O)CCC(=O)NCCOCCOCC(=O)O

Computed by PubChem (NCBI)