CAS 321942-73-8 appears in our catalog under these names: (4-Bromo-2,5-dimethyl-phenylsulfanyl)-acetic acid, 95%, 2-((4-Bromo-2,5-dimethylphenyl)thio)acetic acid, 97%, 2-((4-Bromo-2,5-dimethylphenyl)sulfanyl)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-(4-bromo-2,5-dimethylphenyl)sulfanylacetic acid (CAS 321942-73-8) is a chemical compound with the molecular formula C10H11BrO2S and a molecular weight of 275.16 g/mol. IUPAC name: 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetic acid. InChIKey: DSRRLQXXVLYCHI-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2S |
|---|---|
| Molecular weight | 275.16 g/mol |
| IUPAC name | 2-(4-bromo-2,5-dimethylphenyl)sulfanylacetic acid |
| InChIKey | DSRRLQXXVLYCHI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)C)SCC(=O)O |
Computed by PubChem (NCBI)