CAS 321979-11-7 appears in our catalog under these names: (2E)-3-[4-Methoxy-3-(piperidin-1-ylsulfonyl)phenyl]acrylic acid, 95%, (2E)-3-(4-Methoxy-3-(piperidine-1-sulfonyl)phenyl)prop-2-enoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 10g, 250mg, 50mg, 0,5g.
(E)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enoic acid (CAS 321979-11-7) is a chemical compound with the molecular formula C15H19NO5S and a molecular weight of 325.4 g/mol. IUPAC name: (E)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enoic acid. InChIKey: QKFDASACICBUTH-SOFGYWHQSA-N.
| Molecular formula | C15H19NO5S |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (E)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enoic acid |
| InChIKey | QKFDASACICBUTH-SOFGYWHQSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)O)S(=O)(=O)N2CCCCC2 |
Computed by PubChem (NCBI)