CAS 321995-62-4 appears in our catalog under these names: AGN 194078, 98%, AGN 194078, 98.00%, 98.00%, AGN 194078, 99.87%, AGN 194078 (Standard). Offered by: AmBeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 10 mg, 50 mg, 5 mg, 10mM/1mL.
2,6-difluoro-4-[(3-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)amino]benzoic acid (CAS 321995-62-4) is a chemical compound with the molecular formula C22H23F2NO4 and a molecular weight of 403.4 g/mol. IUPAC name: 2,6-difluoro-4-[(3-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)amino]benzoic acid. InChIKey: BCKLKOYFMACAMZ-UHFFFAOYSA-N.
| Molecular formula | C22H23F2NO4 |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | 2,6-difluoro-4-[(3-hydroxy-5,5,8,8-tetramethyl-6,7-dihydronaphthalene-2-carbonyl)amino]benzoic acid |
| InChIKey | BCKLKOYFMACAMZ-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=C(C(=C2)O)C(=O)NC3=CC(=C(C(=C3)F)C(=O)O)F)(C)C)C |
Computed by PubChem (NCBI)