Products 32221-81-1
CAS 32221-81-1 appears in our catalog under these names: Glutamic acid (sodium salt), 99.92%, Glutamic acid sodium salt, 98%, Sodium 2-amino-4-carboxybutanoate, 98%, Glutamic acid (sodium salt), 98%. Offered by: MedChemExpress, Ambeed, Chemat, Fluorochem. Available pack sizes: 50 mg, 1g, 5g, 25g, 100g, 10g.
Sodium 4-amino-5-hydroxy-5-oxopentanoate (CAS 32221-81-1) is a chemical compound with the molecular formula C5H8NNaO4 and a molecular weight of 169.11 g/mol. IUPAC name: sodium 4-amino-5-hydroxy-5-oxopentanoate. InChIKey: LPUQAYUQRXPFSQ-UHFFFAOYSA-M.
| Molecular formula | C5H8NNaO4 |
|---|---|
| Molecular weight | 169.11 g/mol |
| IUPAC name | sodium 4-amino-5-hydroxy-5-oxopentanoate |
| InChIKey | LPUQAYUQRXPFSQ-UHFFFAOYSA-M |
| SMILES | C(CC(=O)[O-])C(C(=O)O)N.[Na+] |
Computed by PubChem (NCBI)