CAS 32224-57-0 appears in our catalog under these names: (R)-2-Aminoheptanedioic acid, 95%, 95%, (R)-2-Aminoheptanedioic acid, 95+%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
(2R)-2-aminoheptanedioic acid (CAS 32224-57-0) is a chemical compound with the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. IUPAC name: (2R)-2-aminoheptanedioic acid. InChIKey: JUQLUIFNNFIIKC-RXMQYKEDSA-N.
| Molecular formula | C7H13NO4 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | (2R)-2-aminoheptanedioic acid |
| InChIKey | JUQLUIFNNFIIKC-RXMQYKEDSA-N |
| SMILES | C(CCC(=O)O)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)