CAS 322474-07-7 is the registry number for 6-Bromo-2-naphthalenyl-b-D-mannopyranoside. Offered by: Biosynth. Available pack sizes: 1g.
2-(6-bromonaphthalen-2-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 322474-07-7) is a chemical compound with the molecular formula C16H17BrO6 and a molecular weight of 385.21 g/mol. IUPAC name: 2-(6-bromonaphthalen-2-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: NLRXQZJJCPRATR-UHFFFAOYSA-N.
| Molecular formula | C16H17BrO6 |
|---|---|
| Molecular weight | 385.21 g/mol |
| IUPAC name | 2-(6-bromonaphthalen-2-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | NLRXQZJJCPRATR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Br)C=C1OC3C(C(C(C(O3)CO)O)O)O |
Computed by PubChem (NCBI)