CAS 3226-92-4 appears in our catalog under these names: Trt-Phe-OH DEA, 98%, Trt-L-Phe-OH*DEA, Trityl-L-phenylalanine diethylamine. Offered by: Combi-blocks, Iris Biotech, Biosynth. Available pack sizes: 100g, 5g, 25g, 1g, 2g, 10g, 50g.
N-ethylethanamine;(2S)-3-phenyl-2-(tritylamino)propanoic acid (CAS 3226-92-4) is a chemical compound with the molecular formula C32H36N2O2 and a molecular weight of 480.6 g/mol. IUPAC name: N-ethylethanamine;(2S)-3-phenyl-2-(tritylamino)propanoic acid. InChIKey: BSLKHJZVHGFJPR-SNYZSRNZSA-N.
| Molecular formula | C32H36N2O2 |
|---|---|
| Molecular weight | 480.6 g/mol |
| IUPAC name | N-ethylethanamine;(2S)-3-phenyl-2-(tritylamino)propanoic acid |
| InChIKey | BSLKHJZVHGFJPR-SNYZSRNZSA-N |
| SMILES | CCNCC.C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)