CAS 322681-26-5 is the registry number for N-(9-Oxo-9H-fluoren-4-yl)-N'-2-pyridinylurea. Offered by: TRC. Available pack sizes: 250mg.
1-(9-oxofluoren-4-yl)-3-pyridin-2-ylurea (CAS 322681-26-5) is a chemical compound with the molecular formula C19H13N3O2 and a molecular weight of 315.3 g/mol. IUPAC name: 1-(9-oxofluoren-4-yl)-3-pyridin-2-ylurea. InChIKey: XVVDNGPUSVDRAJ-UHFFFAOYSA-N.
| Molecular formula | C19H13N3O2 |
|---|---|
| Molecular weight | 315.3 g/mol |
| IUPAC name | 1-(9-oxofluoren-4-yl)-3-pyridin-2-ylurea |
| InChIKey | XVVDNGPUSVDRAJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C2=O)C=CC=C3NC(=O)NC4=CC=CC=N4 |
Computed by PubChem (NCBI)