Products 322690-84-6

CAS 322690-84-6 is the registry number for 4-(Tributylstannyl)-2-pyridinecarboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-tributylstannylpyridine-2-carboxylate (CAS 322690-84-6) is a chemical compound with the molecular formula C19H33NO2Sn and a molecular weight of 426.2 g/mol. IUPAC name: methyl 4-tributylstannylpyridine-2-carboxylate. InChIKey: MCUWIXCWQPYIMC-UHFFFAOYSA-N.

Identity
Molecular formulaC19H33NO2Sn
Molecular weight426.2 g/mol
IUPAC namemethyl 4-tributylstannylpyridine-2-carboxylate
InChIKeyMCUWIXCWQPYIMC-UHFFFAOYSA-N
SMILESCCCC[Sn](CCCC)(CCCC)C1=CC(=NC=C1)C(=O)OC

Computed by PubChem (NCBI)