Products 32273-88-4

CAS 32273-88-4 is the registry number for 1-Fluorocyclohex-3-ene-1-carboxylic acid 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

1-fluorocyclohex-3-ene-1-carboxylic acid (CAS 32273-88-4) is a chemical compound with the molecular formula C7H9FO2 and a molecular weight of 144.14 g/mol. IUPAC name: 1-fluorocyclohex-3-ene-1-carboxylic acid. InChIKey: FDGRWHMXZNVBFJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9FO2
Molecular weight144.14 g/mol
IUPAC name1-fluorocyclohex-3-ene-1-carboxylic acid
InChIKeyFDGRWHMXZNVBFJ-UHFFFAOYSA-N
SMILESC1CC(CC=C1)(C(=O)O)F

Computed by PubChem (NCBI)