CAS 32303-82-5 is the registry number for Z-Ala-his-ome, 98%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl (2S)-3-(1H-imidazol-5-yl)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate (CAS 32303-82-5) is a chemical compound with the molecular formula C18H22N4O5 and a molecular weight of 374.4 g/mol. IUPAC name: methyl (2S)-3-(1H-imidazol-5-yl)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate. InChIKey: FPMLCYUEXWDCDX-WFASDCNBSA-N.
| Molecular formula | C18H22N4O5 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | methyl (2S)-3-(1H-imidazol-5-yl)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoate |
| InChIKey | FPMLCYUEXWDCDX-WFASDCNBSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CC1=CN=CN1)C(=O)OC)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)