Products 32306-29-9
CAS 32306-29-9 appears in our catalog under these names: Phosphoric acid diethyl ester 5-phenyl-isoxazol-3-yl ester, 95%, Diethyl (5-phenylisoxazol-3-yl) phosphate, 95%, Diethyl (5-phenylisoxazol-3-yl) phosphate, PHOSPHORIC ACID DIETHYL ESTER 5-PHENYL-ISOXAZOL-3-YL ESTER, 95%, 95%, Phosphoric acid diethyl ester 5-phenylisoxazol-3-yl ester, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 250mg, 100mg, 500mg, 1000mg.
Diethyl (5-phenyl-1,2-oxazol-3-yl) phosphate (CAS 32306-29-9) is a chemical compound with the molecular formula C13H16NO5P and a molecular weight of 297.24 g/mol. IUPAC name: diethyl (5-phenyl-1,2-oxazol-3-yl) phosphate. InChIKey: VLBRWDJSOHOVGF-UHFFFAOYSA-N.
| Molecular formula | C13H16NO5P |
|---|---|
| Molecular weight | 297.24 g/mol |
| IUPAC name | diethyl (5-phenyl-1,2-oxazol-3-yl) phosphate |
| InChIKey | VLBRWDJSOHOVGF-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)OC1=NOC(=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
Isoxathion-oxon, Diethyl (5-phenylisoxazol-3-yl) phosphate, Isoxathion oxon, Phosphoric acid diethyl ester 5-phenyl-isoxazol-3-yl ester, diethyl (5-phenyl-1,2-oxazol-3-yl) phosphate, Isoxa oxon, Phosphoric acid diethyl ester 5-phenylisoxazol-3-yl ester, diethyl 5-phenyl-1,2-oxazol-3-yl phosphate, Phosphoric acid diethyl ester5-phenylisoxazol-3-yl ester, Diethyl 5-phenyl-3-isoxazolyl phosphate