CAS 323194-76-9 appears in our catalog under these names: L-Aspartic Acid Sodium Salt Monohydrate, >95% (HPLC), L-Aspartic acid monosodium salt monohydrate, 99% , L-Aspartic acid sodium salt monohydrate, L-Aspartic acid monosodium salt monohydrate, 97%, L-Aspartic acid sodium salt monohydrate, 98.50%. Offered by: TRC, Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific (Acros), Chemat. Available pack sizes: 10g, 50g, 5g, 100g, 500g, 2kg, 1kg, 25g.
Sodium;(2S)-2-amino-4-hydroxy-4-oxobutanoate;hydrate (CAS 323194-76-9) is a chemical compound with the molecular formula C4H8NNaO5 and a molecular weight of 173.10 g/mol. IUPAC name: sodium;(2S)-2-amino-4-hydroxy-4-oxobutanoate;hydrate. InChIKey: PPTHNBYUFXSJPS-JIZZDEOASA-M.
| Molecular formula | C4H8NNaO5 |
|---|---|
| Molecular weight | 173.10 g/mol |
| IUPAC name | sodium;(2S)-2-amino-4-hydroxy-4-oxobutanoate;hydrate |
| InChIKey | PPTHNBYUFXSJPS-JIZZDEOASA-M |
| SMILES | C([C@@H](C(=O)[O-])N)C(=O)O.O.[Na+] |
Computed by PubChem (NCBI)