CAS 32345-65-6 appears in our catalog under these names: (R)-1-(2-Chlorophenyl)ethane-1,2-diol, 95+%, (R)-1-(2-Chlorophenyl)ethane-1,2-diol, 98%, 98%, (R)-1-(2-Chlorophenyl)-1,2-ethanediol, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
(1R)-1-(2-chlorophenyl)ethane-1,2-diol (CAS 32345-65-6) is a chemical compound with the molecular formula C8H9ClO2 and a molecular weight of 172.61 g/mol. IUPAC name: (1R)-1-(2-chlorophenyl)ethane-1,2-diol. InChIKey: YGOPULMDEZVJGI-QMMMGPOBSA-N.
| Molecular formula | C8H9ClO2 |
|---|---|
| Molecular weight | 172.61 g/mol |
| IUPAC name | (1R)-1-(2-chlorophenyl)ethane-1,2-diol |
| InChIKey | YGOPULMDEZVJGI-QMMMGPOBSA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](CO)O)Cl |
Computed by PubChem (NCBI)