CAS 32381-28-5 appears in our catalog under these names: (Ac-cys-ome)2 (disulfide bond), 98%, (Ac-Cys-OMe)2, N,N'-Diacetyl-L-cystine Dimethyl Ester, (Ac–Cys–OMe)₂, Dimethyl diacetyl cystinate 95%. Offered by: Combi-blocks, Creative Peptides, Mikromol, GLPBio, Ambeed. Available pack sizes: 5g, 250mg, 1g, 25mg, 100mg, 250 mg, 50 mg, 100 mg.
Methyl (2R)-2-acetamido-3-[[(2R)-2-acetamido-3-methoxy-3-oxopropyl]disulfanyl]propanoate (CAS 32381-28-5) is a chemical compound with the molecular formula C12H20N2O6S2 and a molecular weight of 352.4 g/mol. IUPAC name: methyl (2R)-2-acetamido-3-[[(2R)-2-acetamido-3-methoxy-3-oxopropyl]disulfanyl]propanoate. InChIKey: ZTTORBNKJFMGIM-UWVGGRQHSA-N.
| Molecular formula | C12H20N2O6S2 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | methyl (2R)-2-acetamido-3-[[(2R)-2-acetamido-3-methoxy-3-oxopropyl]disulfanyl]propanoate |
| InChIKey | ZTTORBNKJFMGIM-UWVGGRQHSA-N |
| SMILES | CC(=O)N[C@@H](CSSC[C@@H](C(=O)OC)NC(=O)C)C(=O)OC |
Computed by PubChem (NCBI)