CAS 324017-23-4 appears in our catalog under these names: Fmoc-aph(cbm)-oh, 98%, Fmoc–ApH(Cbm)–OH, Fmoc-L-Aph(Cbm)-OH, Fmoc-ApH(Cbm)-OH, Fmoc-Aph(Cbm)-OH 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 1g, 100mg, 5g, 250mg, 0,025g, 0,05g, 0,1g, 0,5g.
(2S)-3-[4-(carbamoylamino)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 324017-23-4) is a chemical compound with the molecular formula C25H23N3O5 and a molecular weight of 445.5 g/mol. IUPAC name: (2S)-3-[4-(carbamoylamino)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: HFPDOFBZCSQAEJ-QFIPXVFZSA-N.
| Molecular formula | C25H23N3O5 |
|---|---|
| Molecular weight | 445.5 g/mol |
| IUPAC name | (2S)-3-[4-(carbamoylamino)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | HFPDOFBZCSQAEJ-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=C(C=C4)NC(=O)N)C(=O)O |
Computed by PubChem (NCBI)