Products 324047-27-0

CAS 324047-27-0 is the registry number for Isopropyl Ester of Cetirizine. Offered by: Mikromol. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Propan-2-yl 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate (CAS 324047-27-0) is a chemical compound with the molecular formula C24H31ClN2O3 and a molecular weight of 431.0 g/mol. IUPAC name: propan-2-yl 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate. InChIKey: XYBHROXLOFZZIR-UHFFFAOYSA-N.

Identity
Molecular formulaC24H31ClN2O3
Molecular weight431.0 g/mol
IUPAC namepropan-2-yl 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetate
InChIKeyXYBHROXLOFZZIR-UHFFFAOYSA-N
SMILESCC(C)OC(=O)COCCN1CCN(CC1)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl

Computed by PubChem (NCBI)