CAS 324058-76-6 is the registry number for 1-(4-Chloro-3-nitrobenzenesulfonyl)-4-methylpiperidine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(4-chloro-3-nitrophenyl)sulfonyl-4-methylpiperidine (CAS 324058-76-6) is a chemical compound with the molecular formula C12H15ClN2O4S and a molecular weight of 318.78 g/mol. IUPAC name: 1-(4-chloro-3-nitrophenyl)sulfonyl-4-methylpiperidine. InChIKey: IWCCGUDKOSKNHO-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O4S |
|---|---|
| Molecular weight | 318.78 g/mol |
| IUPAC name | 1-(4-chloro-3-nitrophenyl)sulfonyl-4-methylpiperidine |
| InChIKey | IWCCGUDKOSKNHO-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)S(=O)(=O)C2=CC(=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)