CAS 324068-31-7 is the registry number for 1-[(4-Chloro-3-nitrophenyl)sulfonyl]-4-methylpiperazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg.
1-(4-chloro-3-nitrophenyl)sulfonyl-4-methylpiperazine (CAS 324068-31-7) is a chemical compound with the molecular formula C11H14ClN3O4S and a molecular weight of 319.77 g/mol. IUPAC name: 1-(4-chloro-3-nitrophenyl)sulfonyl-4-methylpiperazine. InChIKey: QVLBUTWRIIGYFT-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O4S |
|---|---|
| Molecular weight | 319.77 g/mol |
| IUPAC name | 1-(4-chloro-3-nitrophenyl)sulfonyl-4-methylpiperazine |
| InChIKey | QVLBUTWRIIGYFT-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)S(=O)(=O)C2=CC(=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)