CAS 32426-11-2 appears in our catalog under these names: N-Octyl-N-decyl-N-dimethylammonium chloride - (as mixture of analogues, Octyl Decyldimethyl Ammonium Chloride, >95% (HPLC), Decyldimethyloctylammonium chloride, N,N–dimethyl–N–octyldecan–1–aminium chloride, Octyldecyldimethylammonium chloride (technical mixture). Offered by: Roth, TRC, Dr. Ehrenstorfer, GLPBio, HPC Standards. Available pack sizes: 5g, 100mg, 1g, 50mg, 100g, 500g, 10g, 25g.
Decyl-dimethyl-octylazanium chloride (CAS 32426-11-2) is a chemical compound with the molecular formula C20H44ClN and a molecular weight of 334.0 g/mol. IUPAC name: decyl-dimethyl-octylazanium chloride. InChIKey: SCXCDVTWABNWLW-UHFFFAOYSA-M.
| Molecular formula | C20H44ClN |
|---|---|
| Molecular weight | 334.0 g/mol |
| IUPAC name | decyl-dimethyl-octylazanium chloride |
| InChIKey | SCXCDVTWABNWLW-UHFFFAOYSA-M |
| SMILES | CCCCCCCCCC[N+](C)(C)CCCCCCCC.[Cl-] |
Computed by PubChem (NCBI)