Products 32451-86-8
CAS 32451-86-8 is the registry number for 5-O-P-COUMAROYLQUINIC ACID. Offered by: Sigma-Aldrich. Available pack sizes: 250MG, 50MG.
(1S,3R,4R,5R)-1,3,4-trihydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoyloxy]cyclohexane-1-carboxylic acid (CAS 32451-86-8) is a chemical compound with the molecular formula C16H18O8 and a molecular weight of 338.31 g/mol. IUPAC name: (1S,3R,4R,5R)-1,3,4-trihydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoyloxy]cyclohexane-1-carboxylic acid. InChIKey: BMRSEYFENKXDIS-NCZKRNLISA-N.
| Molecular formula | C16H18O8 |
|---|---|
| Molecular weight | 338.31 g/mol |
| IUPAC name | (1S,3R,4R,5R)-1,3,4-trihydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoyloxy]cyclohexane-1-carboxylic acid |
| InChIKey | BMRSEYFENKXDIS-NCZKRNLISA-N |
| SMILES | C1[C@H]([C@H]([C@@H](C[C@@]1(C(=O)O)O)OC(=O)C=CC2=CC=C(C=C2)O)O)O |
Computed by PubChem (NCBI)