CAS 324519-66-6 appears in our catalog under these names: (S,E)-5-Chloro-2-isopropylpent-4-enoic acid, 95%, (S,E)-5-Chloro-2-isopropylpent-4-enoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g, 100mg.
(E,2S)-5-chloro-2-propan-2-ylpent-4-enoic acid (CAS 324519-66-6) is a chemical compound with the molecular formula C8H13ClO2 and a molecular weight of 176.64 g/mol. IUPAC name: (E,2S)-5-chloro-2-propan-2-ylpent-4-enoic acid. InChIKey: NOPVMHYFCPFLOH-MZTFZBDOSA-N.
| Molecular formula | C8H13ClO2 |
|---|---|
| Molecular weight | 176.64 g/mol |
| IUPAC name | (E,2S)-5-chloro-2-propan-2-ylpent-4-enoic acid |
| InChIKey | NOPVMHYFCPFLOH-MZTFZBDOSA-N |
| SMILES | CC(C)[C@H](C/C=C/Cl)C(=O)O |
Computed by PubChem (NCBI)