CAS 32454-50-5 is the registry number for Cyclooctanone-2,2,8,8-d4. Offered by: TRC. Available pack sizes: 100mg.
2,2,8,8-tetradeuteriocyclooctan-1-one (CAS 32454-50-5) is a chemical compound with the molecular formula C8H14O and a molecular weight of 130.22 g/mol. IUPAC name: 2,2,8,8-tetradeuteriocyclooctan-1-one. InChIKey: IIRFCWANHMSDCG-KXGHAPEVSA-N.
| Molecular formula | C8H14O |
|---|---|
| Molecular weight | 130.22 g/mol |
| IUPAC name | 2,2,8,8-tetradeuteriocyclooctan-1-one |
| InChIKey | IIRFCWANHMSDCG-KXGHAPEVSA-N |
| SMILES | [2H]C1(CCCCCC(C1=O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)